C9H14F3N5O — CID 103369725
3,3,3-trifluoro-N'-hydroxy-2-[[(1-methylimidazol-2-yl)methylamino]methyl]propanimidamide (PubChem CID 103369725) has the molecular formula C9H14F3N5O and a molecular weight of 265.24 g/mol. Its IUPAC name is 3,3,3-trifluoro-N'-hydroxy-2-[[(1-methylimidazol-2-yl)methylamino]methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-N'-hydroxy-2-[[(1-methylimidazol-2-yl)methylamino]methyl]propanimidamide |
|---|---|
| PubChem CID | 103369725 |
| Molecular Formula | C9H14F3N5O |
| Molecular Weight | 265.24 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 3,3,3-trifluoro-N'-hydroxy-2-[[(1-methylimidazol-2-yl)methylamino]methyl]propanimidamide |
| SMILES | Cn1ccnc1CNCC(/C(N)=N/O)C(F)(F)F |
| InChI | InChI=1S/C9H14F3N5O/c1-17-3-2-15-7(17)5-14-4-6(8(13)16-18)9(10,11)12/h2-3,6,14,18H,4-5H2,1H3,(H2,13,16) |
| InChIKey | YGOLUHDCUIWNDG-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.24 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|