C10H19N5O — CID 77031327
N'-hydroxy-2-[2-(1-methylimidazol-2-yl)ethylamino]butanimidamide (PubChem CID 77031327) has the molecular formula C10H19N5O and a molecular weight of 225.30 g/mol. Its IUPAC name is N'-hydroxy-2-[2-(1-methylimidazol-2-yl)ethylamino]butanimidamide.
| Compound Name | N'-hydroxy-2-[2-(1-methylimidazol-2-yl)ethylamino]butanimidamide |
|---|---|
| PubChem CID | 77031327 |
| Molecular Formula | C10H19N5O |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | N'-hydroxy-2-[2-(1-methylimidazol-2-yl)ethylamino]butanimidamide |
| SMILES | CCC(NCCc1nccn1C)C(N)=NO |
| InChI | InChI=1S/C10H19N5O/c1-3-8(10(11)14-16)12-5-4-9-13-6-7-15(9)2/h6-8,12,16H,3-5H2,1-2H3,(H2,11,14) |
| InChIKey | PCRWJMNMMCEUEU-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|