C10H17N3O3 — CID 103247006
3-methoxy-2-[2-(1-methylimidazol-2-yl)ethylamino]propanoic acid (PubChem CID 103247006) has the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. Its IUPAC name is 3-methoxy-2-[2-(1-methylimidazol-2-yl)ethylamino]propanoic acid.
| Compound Name | 3-methoxy-2-[2-(1-methylimidazol-2-yl)ethylamino]propanoic acid |
|---|---|
| PubChem CID | 103247006 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 3-methoxy-2-[2-(1-methylimidazol-2-yl)ethylamino]propanoic acid |
| SMILES | COCC(NCCc1nccn1C)C(=O)O |
| InChI | InChI=1S/C10H17N3O3/c1-13-6-5-12-9(13)3-4-11-8(7-16-2)10(14)15/h5-6,8,11H,3-4,7H2,1-2H3,(H,14,15) |
| InChIKey | AUSJQFIBIVJNHD-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |