C13H25N5O — CID 77063115
N'-hydroxy-2,2-dimethyl-5-[2-(1-methylimidazol-2-yl)ethylamino]pentanimidamide (PubChem CID 77063115) has the molecular formula C13H25N5O and a molecular weight of 267.38 g/mol. Its IUPAC name is N'-hydroxy-2,2-dimethyl-5-[2-(1-methylimidazol-2-yl)ethylamino]pentanimidamide.
| Compound Name | N'-hydroxy-2,2-dimethyl-5-[2-(1-methylimidazol-2-yl)ethylamino]pentanimidamide |
|---|---|
| PubChem CID | 77063115 |
| Molecular Formula | C13H25N5O |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.21 |
| IUPAC Name | N'-hydroxy-2,2-dimethyl-5-[2-(1-methylimidazol-2-yl)ethylamino]pentanimidamide |
| SMILES | Cn1ccnc1CCNCCCC(C)(C)C(N)=NO |
| InChI | InChI=1S/C13H25N5O/c1-13(2,12(14)17-19)6-4-7-15-8-5-11-16-9-10-18(11)3/h9-10,15,19H,4-8H2,1-3H3,(H2,14,17) |
| InChIKey | AWWCDPNJGRLNNQ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|