C11H19F3N4O — CID 103369819
3,3,3-trifluoro-2-[(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)methyl]-N'-hydroxypropanimidamide (PubChem CID 103369819) has the molecular formula C11H19F3N4O and a molecular weight of 280.29 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)methyl]-N'-hydroxypropanimidamide.
| Compound Name | 3,3,3-trifluoro-2-[(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)methyl]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 103369819 |
| Molecular Formula | C11H19F3N4O |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 3,3,3-trifluoro-2-[(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)methyl]-N'-hydroxypropanimidamide |
| SMILES | NC(=NO)C(CNC1CCN2CCCC12)C(F)(F)F |
| InChI | InChI=1S/C11H19F3N4O/c12-11(13,14)7(10(15)17-19)6-16-8-3-5-18-4-1-2-9(8)18/h7-9,16,19H,1-6H2,(H2,15,17) |
| InChIKey | ZOAJJBPPUOICEY-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|