C11H21N3O2 — CID 106171487
3-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)-2-hydroxypropanamide (PubChem CID 106171487) has the molecular formula C11H21N3O2 and a molecular weight of 227.31 g/mol. Its IUPAC name is 3-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)-2-hydroxypropanamide.
| Compound Name | 3-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106171487 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | 3-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)-2-hydroxypropanamide |
| SMILES | NC(=O)C(O)CNC1CCN2CCCCC12 |
| InChI | InChI=1S/C11H21N3O2/c12-11(16)10(15)7-13-8-4-6-14-5-2-1-3-9(8)14/h8-10,13,15H,1-7H2,(H2,12,16) |
| InChIKey | NMGFWPZAYNAOQW-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |