C15H28N2O — CID 114178522
[2-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)cyclohexyl]methanol (PubChem CID 114178522) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is [2-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)cyclohexyl]methanol.
| Compound Name | [2-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)cyclohexyl]methanol |
|---|---|
| PubChem CID | 114178522 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | [2-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)cyclohexyl]methanol |
| SMILES | OCC1CCCCC1NC1CCN2CCCCC12 |
| InChI | InChI=1S/C15H28N2O/c18-11-12-5-1-2-6-13(12)16-14-8-10-17-9-4-3-7-15(14)17/h12-16,18H,1-11H2 |
| InChIKey | DREKWTLJJCEHJG-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |