C13H24N2O — CID 102733298
trans-(1S,2S)-2-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)cyclopentan-1-ol (PubChem CID 102733298) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is trans-(1S,2S)-2-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)cyclopentan-1-ol.
| Compound Name | trans-(1S,2S)-2-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)cyclopentan-1-ol |
|---|---|
| PubChem CID | 102733298 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | trans-(1S,2S)-2-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)cyclopentan-1-ol |
| SMILES | O[C@H]1CCC[C@@H]1NC1CCN2CCCCC12 |
| InChI | InChI=1S/C13H24N2O/c16-13-6-3-4-11(13)14-10-7-9-15-8-2-1-5-12(10)15/h10-14,16H,1-9H2/t10?,11-,12?,13-/m0/s1 |
| InChIKey | BUYSUXKNQWAGAD-MVKMKZAISA-N |
| XLogP | 1.12 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |