C13H24F3N3O2 — CID 103369909
2-[[(4-ethyl-1-hydroxycyclohexyl)methylamino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide (PubChem CID 103369909) has the molecular formula C13H24F3N3O2 and a molecular weight of 311.35 g/mol. Its IUPAC name is 2-[[(4-ethyl-1-hydroxycyclohexyl)methylamino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide.
| Compound Name | 2-[[(4-ethyl-1-hydroxycyclohexyl)methylamino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 103369909 |
| Molecular Formula | C13H24F3N3O2 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | 2-[[(4-ethyl-1-hydroxycyclohexyl)methylamino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
| SMILES | CCC1CCC(O)(CNCC(C(N)=NO)C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H24F3N3O2/c1-2-9-3-5-12(20,6-4-9)8-18-7-10(11(17)19-21)13(14,15)16/h9-10,18,20-21H,2-8H2,1H3,(H2,17,19) |
| InChIKey | DLVAWLMFATVOOQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|