C8H14F3N3O — CID 103370232
3,3,3-trifluoro-N'-hydroxy-2-[(2-methylprop-2-enylamino)methyl]propanimidamide (PubChem CID 103370232) has the molecular formula C8H14F3N3O and a molecular weight of 225.21 g/mol. Its IUPAC name is 3,3,3-trifluoro-N'-hydroxy-2-[(2-methylprop-2-enylamino)methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-N'-hydroxy-2-[(2-methylprop-2-enylamino)methyl]propanimidamide |
|---|---|
| PubChem CID | 103370232 |
| Molecular Formula | C8H14F3N3O |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 3,3,3-trifluoro-N'-hydroxy-2-[(2-methylprop-2-enylamino)methyl]propanimidamide |
| SMILES | C=C(C)CNCC(C(N)=NO)C(F)(F)F |
| InChI | InChI=1S/C8H14F3N3O/c1-5(2)3-13-4-6(7(12)14-15)8(9,10)11/h6,13,15H,1,3-4H2,2H3,(H2,12,14) |
| InChIKey | MVUBKVXVYODONH-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|