C9H18F3N3O3 — CID 114100374
2-[(2,3-dimethoxypropylamino)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide (PubChem CID 114100374) has the molecular formula C9H18F3N3O3 and a molecular weight of 273.25 g/mol. Its IUPAC name is 2-[(2,3-dimethoxypropylamino)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide.
| Compound Name | 2-[(2,3-dimethoxypropylamino)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 114100374 |
| Molecular Formula | C9H18F3N3O3 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2-[(2,3-dimethoxypropylamino)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
| SMILES | COCC(CNCC(C(N)=NO)C(F)(F)F)OC |
| InChI | InChI=1S/C9H18F3N3O3/c1-17-5-6(18-2)3-14-4-7(8(13)15-16)9(10,11)12/h6-7,14,16H,3-5H2,1-2H3,(H2,13,15) |
| InChIKey | KOQSHNTVTLYBCX-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|