C8H16F3N3O2 — CID 103370247
3,3,3-trifluoro-N'-hydroxy-2-[(2-methoxypropylamino)methyl]propanimidamide (PubChem CID 103370247) has the molecular formula C8H16F3N3O2 and a molecular weight of 243.23 g/mol. Its IUPAC name is 3,3,3-trifluoro-N'-hydroxy-2-[(2-methoxypropylamino)methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-N'-hydroxy-2-[(2-methoxypropylamino)methyl]propanimidamide |
|---|---|
| PubChem CID | 103370247 |
| Molecular Formula | C8H16F3N3O2 |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 3,3,3-trifluoro-N'-hydroxy-2-[(2-methoxypropylamino)methyl]propanimidamide |
| SMILES | COC(C)CNCC(C(N)=NO)C(F)(F)F |
| InChI | InChI=1S/C8H16F3N3O2/c1-5(16-2)3-13-4-6(7(12)14-15)8(9,10)11/h5-6,13,15H,3-4H2,1-2H3,(H2,12,14) |
| InChIKey | QNUDBRWDIVOHJX-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|