C10H18F3N3O — CID 103370528
2-[(2,6-dimethylmorpholin-4-yl)methyl]-3,3,3-trifluoropropanimidamide (PubChem CID 103370528) has the molecular formula C10H18F3N3O and a molecular weight of 253.27 g/mol. Its IUPAC name is 2-[(2,6-dimethylmorpholin-4-yl)methyl]-3,3,3-trifluoropropanimidamide.
| Compound Name | 2-[(2,6-dimethylmorpholin-4-yl)methyl]-3,3,3-trifluoropropanimidamide |
|---|---|
| PubChem CID | 103370528 |
| Molecular Formula | C10H18F3N3O |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 2-[(2,6-dimethylmorpholin-4-yl)methyl]-3,3,3-trifluoropropanimidamide |
| SMILES | [H]/N=C(\N)C(CN1CC(C)OC(C)C1)C(F)(F)F |
| InChI | InChI=1S/C10H18F3N3O/c1-6-3-16(4-7(2)17-6)5-8(9(14)15)10(11,12)13/h6-8H,3-5H2,1-2H3,(H3,14,15) |
| InChIKey | DBJCHVNOTRXYES-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|