C12H17F3N4 — CID 103370556
3,3,3-trifluoro-2-[[methyl(2-pyridin-2-ylethyl)amino]methyl]propanimidamide (PubChem CID 103370556) has the molecular formula C12H17F3N4 and a molecular weight of 274.29 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[[methyl(2-pyridin-2-ylethyl)amino]methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-2-[[methyl(2-pyridin-2-ylethyl)amino]methyl]propanimidamide |
|---|---|
| PubChem CID | 103370556 |
| Molecular Formula | C12H17F3N4 |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 3,3,3-trifluoro-2-[[methyl(2-pyridin-2-ylethyl)amino]methyl]propanimidamide |
| SMILES | [H]/N=C(\N)C(CN(C)CCc1ccccn1)C(F)(F)F |
| InChI | InChI=1S/C12H17F3N4/c1-19(7-5-9-4-2-3-6-18-9)8-10(11(16)17)12(13,14)15/h2-4,6,10H,5,7-8H2,1H3,(H3,16,17) |
| InChIKey | DSNVYKKQWYVYCP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|