C11H14F3N3 — CID 103370527
3,3,3-trifluoro-2-[(N-methylanilino)methyl]propanimidamide (PubChem CID 103370527) has the molecular formula C11H14F3N3 and a molecular weight of 245.25 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(N-methylanilino)methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-2-[(N-methylanilino)methyl]propanimidamide |
|---|---|
| PubChem CID | 103370527 |
| Molecular Formula | C11H14F3N3 |
| Molecular Weight | 245.25 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 3,3,3-trifluoro-2-[(N-methylanilino)methyl]propanimidamide |
| SMILES | [H]/N=C(\N)C(CN(C)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H14F3N3/c1-17(8-5-3-2-4-6-8)7-9(10(15)16)11(12,13)14/h2-6,9H,7H2,1H3,(H3,15,16) |
| InChIKey | ZPIDQTHIWJOUPN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|