C12H16F3N3O — CID 103370690
3,3,3-trifluoro-2-[(3-methoxy-N-methylanilino)methyl]propanimidamide (PubChem CID 103370690) has the molecular formula C12H16F3N3O and a molecular weight of 275.27 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(3-methoxy-N-methylanilino)methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-2-[(3-methoxy-N-methylanilino)methyl]propanimidamide |
|---|---|
| PubChem CID | 103370690 |
| Molecular Formula | C12H16F3N3O |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 3,3,3-trifluoro-2-[(3-methoxy-N-methylanilino)methyl]propanimidamide |
| SMILES | [H]/N=C(\N)C(CN(C)c1cccc(OC)c1)C(F)(F)F |
| InChI | InChI=1S/C12H16F3N3O/c1-18(7-10(11(16)17)12(13,14)15)8-4-3-5-9(6-8)19-2/h3-6,10H,7H2,1-2H3,(H3,16,17) |
| InChIKey | FAEWBXKHALDFPC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|