C13H18F3N3O — CID 103370622
3,3,3-trifluoro-2-[[(2-methoxyphenyl)methyl-methylamino]methyl]propanimidamide (PubChem CID 103370622) has the molecular formula C13H18F3N3O and a molecular weight of 289.30 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[[(2-methoxyphenyl)methyl-methylamino]methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-2-[[(2-methoxyphenyl)methyl-methylamino]methyl]propanimidamide |
|---|---|
| PubChem CID | 103370622 |
| Molecular Formula | C13H18F3N3O |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 3,3,3-trifluoro-2-[[(2-methoxyphenyl)methyl-methylamino]methyl]propanimidamide |
| SMILES | [H]/N=C(\N)C(CN(C)Cc1ccccc1OC)C(F)(F)F |
| InChI | InChI=1S/C13H18F3N3O/c1-19(8-10(12(17)18)13(14,15)16)7-9-5-3-4-6-11(9)20-2/h3-6,10H,7-8H2,1-2H3,(H3,17,18) |
| InChIKey | YUPICXATWFODFO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|