C11H18N2O — CID 28772492
(2S)-1-N-(3-methoxyphenyl)-1-N-methylpropane-1,2-diamine (PubChem CID 28772492) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is (2S)-1-N-(3-methoxyphenyl)-1-N-methylpropane-1,2-diamine.
| Compound Name | (2S)-1-N-(3-methoxyphenyl)-1-N-methylpropane-1,2-diamine |
|---|---|
| PubChem CID | 28772492 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | (2S)-1-N-(3-methoxyphenyl)-1-N-methylpropane-1,2-diamine |
| SMILES | COc1cccc(N(C)C[C@H](C)N)c1 |
| InChI | InChI=1S/C11H18N2O/c1-9(12)8-13(2)10-5-4-6-11(7-10)14-3/h4-7,9H,8,12H2,1-3H3/t9-/m0/s1 |
| InChIKey | LOLQZXQIFGVFNL-VIFPVBQESA-N |
| XLogP | 1.48 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |