C12H22F3N3 — CID 103370642
3,3,3-trifluoro-2-[[methyl-(3-methylcyclohexyl)amino]methyl]propanimidamide (PubChem CID 103370642) has the molecular formula C12H22F3N3 and a molecular weight of 265.32 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[[methyl-(3-methylcyclohexyl)amino]methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-2-[[methyl-(3-methylcyclohexyl)amino]methyl]propanimidamide |
|---|---|
| PubChem CID | 103370642 |
| Molecular Formula | C12H22F3N3 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 3,3,3-trifluoro-2-[[methyl-(3-methylcyclohexyl)amino]methyl]propanimidamide |
| SMILES | [H]/N=C(\N)C(CN(C)C1CCCC(C)C1)C(F)(F)F |
| InChI | InChI=1S/C12H22F3N3/c1-8-4-3-5-9(6-8)18(2)7-10(11(16)17)12(13,14)15/h8-10H,3-7H2,1-2H3,(H3,16,17) |
| InChIKey | CKVMFOJCTJECQJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|