C11H20F3N3 — CID 103370638
2-[[cyclopropylmethyl(propyl)amino]methyl]-3,3,3-trifluoropropanimidamide (PubChem CID 103370638) has the molecular formula C11H20F3N3 and a molecular weight of 251.30 g/mol. Its IUPAC name is 2-[[cyclopropylmethyl(propyl)amino]methyl]-3,3,3-trifluoropropanimidamide.
| Compound Name | 2-[[cyclopropylmethyl(propyl)amino]methyl]-3,3,3-trifluoropropanimidamide |
|---|---|
| PubChem CID | 103370638 |
| Molecular Formula | C11H20F3N3 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 2-[[cyclopropylmethyl(propyl)amino]methyl]-3,3,3-trifluoropropanimidamide |
| SMILES | [H]/N=C(\N)C(CN(CCC)CC1CC1)C(F)(F)F |
| InChI | InChI=1S/C11H20F3N3/c1-2-5-17(6-8-3-4-8)7-9(10(15)16)11(12,13)14/h8-9H,2-7H2,1H3,(H3,15,16) |
| InChIKey | LUWQLVAMNRERQH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|