C13H24F3N3 — CID 103370793
2-[[cyclopentyl(2-methylpropyl)amino]methyl]-3,3,3-trifluoropropanimidamide (PubChem CID 103370793) has the molecular formula C13H24F3N3 and a molecular weight of 279.35 g/mol. Its IUPAC name is 2-[[cyclopentyl(2-methylpropyl)amino]methyl]-3,3,3-trifluoropropanimidamide.
| Compound Name | 2-[[cyclopentyl(2-methylpropyl)amino]methyl]-3,3,3-trifluoropropanimidamide |
|---|---|
| PubChem CID | 103370793 |
| Molecular Formula | C13H24F3N3 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | 2-[[cyclopentyl(2-methylpropyl)amino]methyl]-3,3,3-trifluoropropanimidamide |
| SMILES | [H]/N=C(\N)C(CN(CC(C)C)C1CCCC1)C(F)(F)F |
| InChI | InChI=1S/C13H24F3N3/c1-9(2)7-19(10-5-3-4-6-10)8-11(12(17)18)13(14,15)16/h9-11H,3-8H2,1-2H3,(H3,17,18) |
| InChIKey | LIOXWPZSQSUTBJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|