C9H15F3N2S — CID 103371449
2-(cyclopentylsulfanylmethyl)-3,3,3-trifluoropropanimidamide (PubChem CID 103371449) has the molecular formula C9H15F3N2S and a molecular weight of 240.29 g/mol. Its IUPAC name is 2-(cyclopentylsulfanylmethyl)-3,3,3-trifluoropropanimidamide.
| Compound Name | 2-(cyclopentylsulfanylmethyl)-3,3,3-trifluoropropanimidamide |
|---|---|
| PubChem CID | 103371449 |
| Molecular Formula | C9H15F3N2S |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 2-(cyclopentylsulfanylmethyl)-3,3,3-trifluoropropanimidamide |
| SMILES | [H]/N=C(\N)C(CSC1CCCC1)C(F)(F)F |
| InChI | InChI=1S/C9H15F3N2S/c10-9(11,12)7(8(13)14)5-15-6-3-1-2-4-6/h6-7H,1-5H2,(H3,13,14) |
| InChIKey | JWORAJGBJOUJKA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|