C6H11F3N2OS — CID 103371422
3,3,3-trifluoro-2-(2-hydroxyethylsulfanylmethyl)propanimidamide (PubChem CID 103371422) has the molecular formula C6H11F3N2OS and a molecular weight of 216.23 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(2-hydroxyethylsulfanylmethyl)propanimidamide.
| Compound Name | 3,3,3-trifluoro-2-(2-hydroxyethylsulfanylmethyl)propanimidamide |
|---|---|
| PubChem CID | 103371422 |
| Molecular Formula | C6H11F3N2OS |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 3,3,3-trifluoro-2-(2-hydroxyethylsulfanylmethyl)propanimidamide |
| SMILES | [H]/N=C(\N)C(CSCCO)C(F)(F)F |
| InChI | InChI=1S/C6H11F3N2OS/c7-6(8,9)4(5(10)11)3-13-2-1-12/h4,12H,1-3H2,(H3,10,11) |
| InChIKey | JGWWWLYZIPEXOD-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 70.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|