C9H12F3N5OS — CID 103371445
2-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-3,3,3-trifluoropropanimidamide (PubChem CID 103371445) has the molecular formula C9H12F3N5OS and a molecular weight of 295.29 g/mol. Its IUPAC name is 2-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-3,3,3-trifluoropropanimidamide.
| Compound Name | 2-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-3,3,3-trifluoropropanimidamide |
|---|---|
| PubChem CID | 103371445 |
| Molecular Formula | C9H12F3N5OS |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 2-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-3,3,3-trifluoropropanimidamide |
| SMILES | [H]/N=C(\N)C(CSc1n[nH]c(=O)n1C1CC1)C(F)(F)F |
| InChI | InChI=1S/C9H12F3N5OS/c10-9(11,12)5(6(13)14)3-19-8-16-15-7(18)17(8)4-1-2-4/h4-5H,1-3H2,(H3,13,14)(H,15,18) |
| InChIKey | LWYABQUQIFQYAB-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|