C11H19N5OS — CID 65251417
4-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-2,2-dimethylbutanimidamide (PubChem CID 65251417) has the molecular formula C11H19N5OS and a molecular weight of 269.37 g/mol. Its IUPAC name is 4-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-2,2-dimethylbutanimidamide.
| Compound Name | 4-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-2,2-dimethylbutanimidamide |
|---|---|
| PubChem CID | 65251417 |
| Molecular Formula | C11H19N5OS |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 4-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-2,2-dimethylbutanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCSc1n[nH]c(=O)n1C1CC1 |
| InChI | InChI=1S/C11H19N5OS/c1-11(2,8(12)13)5-6-18-10-15-14-9(17)16(10)7-3-4-7/h7H,3-6H2,1-2H3,(H3,12,13)(H,14,17) |
| InChIKey | SYVRWPCTOVPQMI-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|