C12H22N4OS — CID 62882553
3-[3-(tert-butylamino)propylsulfanyl]-4-cyclopropyl-1H-1,2,4-triazol-5-one (PubChem CID 62882553) has the molecular formula C12H22N4OS and a molecular weight of 270.40 g/mol. Its IUPAC name is 3-[3-(tert-butylamino)propylsulfanyl]-4-cyclopropyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-[3-(tert-butylamino)propylsulfanyl]-4-cyclopropyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 62882553 |
| Molecular Formula | C12H22N4OS |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 3-[3-(tert-butylamino)propylsulfanyl]-4-cyclopropyl-1H-1,2,4-triazol-5-one |
| SMILES | CC(C)(C)NCCCSc1n[nH]c(=O)n1C1CC1 |
| InChI | InChI=1S/C12H22N4OS/c1-12(2,3)13-7-4-8-18-11-15-14-10(17)16(11)9-5-6-9/h9,13H,4-8H2,1-3H3,(H,14,17) |
| InChIKey | NVHMOZPMWYTCPI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|