C16H20N4O2S2 — CID 17413842
2-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(3-phenylsulfanylpropyl)acetamide (PubChem CID 17413842) has the molecular formula C16H20N4O2S2 and a molecular weight of 364.50 g/mol. Its IUPAC name is 2-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(3-phenylsulfanylpropyl)acetamide.
| Compound Name | 2-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(3-phenylsulfanylpropyl)acetamide |
|---|---|
| PubChem CID | 17413842 |
| Molecular Formula | C16H20N4O2S2 |
| Molecular Weight | 364.50 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 2-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(3-phenylsulfanylpropyl)acetamide |
| SMILES | O=C(CSc1n[nH]c(=O)n1C1CC1)NCCCSc1ccccc1 |
| InChI | InChI=1S/C16H20N4O2S2/c21-14(17-9-4-10-23-13-5-2-1-3-6-13)11-24-16-19-18-15(22)20(16)12-7-8-12/h1-3,5-6,12H,4,7-11H2,(H,17,21)(H,18,22) |
| InChIKey | JHYFXHFTFASKFH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.50 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|