C12H12ClN5O2S — CID 9347445
N-(2-chloro-3-pyridinyl)-2-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 9347445) has the molecular formula C12H12ClN5O2S and a molecular weight of 325.78 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 9347445 |
| Molecular Formula | C12H12ClN5O2S |
| Molecular Weight | 325.78 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1n[nH]c(=O)n1C1CC1)Nc1cccnc1Cl |
| InChI | InChI=1S/C12H12ClN5O2S/c13-10-8(2-1-5-14-10)15-9(19)6-21-12-17-16-11(20)18(12)7-3-4-7/h1-2,5,7H,3-4,6H2,(H,15,19)(H,16,20) |
| InChIKey | RVMQFWAEVOQBIB-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.78 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|