C17H15ClN6OS — CID 8722581
N-(2-chloro-3-pyridinyl)-2-[(4-cyclopropyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 8722581) has the molecular formula C17H15ClN6OS and a molecular weight of 386.87 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-[(4-cyclopropyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-[(4-cyclopropyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 8722581 |
| Molecular Formula | C17H15ClN6OS |
| Molecular Weight | 386.87 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-[(4-cyclopropyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nnc(-c2ccncc2)n1C1CC1)Nc1cccnc1Cl |
| InChI | InChI=1S/C17H15ClN6OS/c18-15-13(2-1-7-20-15)21-14(25)10-26-17-23-22-16(24(17)12-3-4-12)11-5-8-19-9-6-11/h1-2,5-9,12H,3-4,10H2,(H,21,25) |
| InChIKey | NGEQTYXWQIEWDI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.87 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|