C21H21ClFN5OS — CID 4240315
N-(2-chloro-3-pyridinyl)-2-[[4-cyclohexyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 4240315) has the molecular formula C21H21ClFN5OS and a molecular weight of 445.95 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-[[4-cyclohexyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-[[4-cyclohexyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 4240315 |
| Molecular Formula | C21H21ClFN5OS |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-[[4-cyclohexyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nnc(-c2ccccc2F)n1C1CCCCC1)Nc1cccnc1Cl |
| InChI | InChI=1S/C21H21ClFN5OS/c22-19-17(11-6-12-24-19)25-18(29)13-30-21-27-26-20(15-9-4-5-10-16(15)23)28(21)14-7-2-1-3-8-14/h4-6,9-12,14H,1-3,7-8,13H2,(H,25,29) |
| InChIKey | SUVFIHOXJQEOKY-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|