C13H11F3N4O2S — CID 9346686
2-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 9346686) has the molecular formula C13H11F3N4O2S and a molecular weight of 344.32 g/mol. Its IUPAC name is 2-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 9346686 |
| Molecular Formula | C13H11F3N4O2S |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 2-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(CSc1n[nH]c(=O)n1C1CC1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H11F3N4O2S/c14-7-3-4-8(11(16)10(7)15)17-9(21)5-23-13-19-18-12(22)20(13)6-1-2-6/h3-4,6H,1-2,5H2,(H,17,21)(H,18,22) |
| InChIKey | SYBDBJKOPNJRJV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|