C10H18F3N3O — CID 103370849
3,3,3-trifluoro-2-[(3-methoxypiperidin-1-yl)methyl]propanimidamide (PubChem CID 103370849) has the molecular formula C10H18F3N3O and a molecular weight of 253.27 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(3-methoxypiperidin-1-yl)methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-2-[(3-methoxypiperidin-1-yl)methyl]propanimidamide |
|---|---|
| PubChem CID | 103370849 |
| Molecular Formula | C10H18F3N3O |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 3,3,3-trifluoro-2-[(3-methoxypiperidin-1-yl)methyl]propanimidamide |
| SMILES | [H]/N=C(\N)C(CN1CCCC(OC)C1)C(F)(F)F |
| InChI | InChI=1S/C10H18F3N3O/c1-17-7-3-2-4-16(5-7)6-8(9(14)15)10(11,12)13/h7-8H,2-6H2,1H3,(H3,14,15) |
| InChIKey | LKNVHOBAXYTUBI-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|