C10H17BrF3N — CID 64758757
N-(2-bromo-3,3,3-trifluoropropyl)-N-(2-methylpropyl)cyclopropanamine (PubChem CID 64758757) has the molecular formula C10H17BrF3N and a molecular weight of 288.15 g/mol. Its IUPAC name is N-(2-bromo-3,3,3-trifluoropropyl)-N-(2-methylpropyl)cyclopropanamine.
| Compound Name | N-(2-bromo-3,3,3-trifluoropropyl)-N-(2-methylpropyl)cyclopropanamine |
|---|---|
| PubChem CID | 64758757 |
| Molecular Formula | C10H17BrF3N |
| Molecular Weight | 288.15 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | N-(2-bromo-3,3,3-trifluoropropyl)-N-(2-methylpropyl)cyclopropanamine |
| SMILES | CC(C)CN(CC(Br)C(F)(F)F)C1CC1 |
| InChI | InChI=1S/C10H17BrF3N/c1-7(2)5-15(8-3-4-8)6-9(11)10(12,13)14/h7-9H,3-6H2,1-2H3 |
| InChIKey | HADCRWLYFSYDJE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.15 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|