C12H23BrF3N — CID 79484154
N-(2-bromo-3,3,3-trifluoropropyl)-N-(2-methylpropyl)pentan-3-amine (PubChem CID 79484154) has the molecular formula C12H23BrF3N and a molecular weight of 318.22 g/mol. Its IUPAC name is N-(2-bromo-3,3,3-trifluoropropyl)-N-(2-methylpropyl)pentan-3-amine.
| Compound Name | N-(2-bromo-3,3,3-trifluoropropyl)-N-(2-methylpropyl)pentan-3-amine |
|---|---|
| PubChem CID | 79484154 |
| Molecular Formula | C12H23BrF3N |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | N-(2-bromo-3,3,3-trifluoropropyl)-N-(2-methylpropyl)pentan-3-amine |
| SMILES | CCC(CC)N(CC(C)C)CC(Br)C(F)(F)F |
| InChI | InChI=1S/C12H23BrF3N/c1-5-10(6-2)17(7-9(3)4)8-11(13)12(14,15)16/h9-11H,5-8H2,1-4H3 |
| InChIKey | VAPZQXHKCNRACT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|