C9H17BrF3N — CID 64757931
N-(2-bromo-3,3,3-trifluoropropyl)-N-ethyl-2-methylpropan-1-amine (PubChem CID 64757931) has the molecular formula C9H17BrF3N and a molecular weight of 276.14 g/mol. Its IUPAC name is N-(2-bromo-3,3,3-trifluoropropyl)-N-ethyl-2-methylpropan-1-amine.
| Compound Name | N-(2-bromo-3,3,3-trifluoropropyl)-N-ethyl-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 64757931 |
| Molecular Formula | C9H17BrF3N |
| Molecular Weight | 276.14 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | N-(2-bromo-3,3,3-trifluoropropyl)-N-ethyl-2-methylpropan-1-amine |
| SMILES | CCN(CC(C)C)CC(Br)C(F)(F)F |
| InChI | InChI=1S/C9H17BrF3N/c1-4-14(5-7(2)3)6-8(10)9(11,12)13/h7-8H,4-6H2,1-3H3 |
| InChIKey | OPOLDWKETIKFFG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.14 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|