C13H13F3N4 — CID 103370864
3,3,3-trifluoro-2-[(2-phenylimidazol-1-yl)methyl]propanimidamide (PubChem CID 103370864) has the molecular formula C13H13F3N4 and a molecular weight of 282.27 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(2-phenylimidazol-1-yl)methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-2-[(2-phenylimidazol-1-yl)methyl]propanimidamide |
|---|---|
| PubChem CID | 103370864 |
| Molecular Formula | C13H13F3N4 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 3,3,3-trifluoro-2-[(2-phenylimidazol-1-yl)methyl]propanimidamide |
| SMILES | [H]/N=C(\N)C(Cn1ccnc1-c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H13F3N4/c14-13(15,16)10(11(17)18)8-20-7-6-19-12(20)9-4-2-1-3-5-9/h1-7,10H,8H2,(H3,17,18) |
| InChIKey | AJQKWXIIVQZMOP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 67.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|