C12H22F3N3O — CID 103370844
3,3,3-trifluoro-2-[(2,2,6,6-tetramethylmorpholin-4-yl)methyl]propanimidamide (PubChem CID 103370844) has the molecular formula C12H22F3N3O and a molecular weight of 281.32 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(2,2,6,6-tetramethylmorpholin-4-yl)methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-2-[(2,2,6,6-tetramethylmorpholin-4-yl)methyl]propanimidamide |
|---|---|
| PubChem CID | 103370844 |
| Molecular Formula | C12H22F3N3O |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 3,3,3-trifluoro-2-[(2,2,6,6-tetramethylmorpholin-4-yl)methyl]propanimidamide |
| SMILES | [H]/N=C(\N)C(CN1CC(C)(C)OC(C)(C)C1)C(F)(F)F |
| InChI | InChI=1S/C12H22F3N3O/c1-10(2)6-18(7-11(3,4)19-10)5-8(9(16)17)12(13,14)15/h8H,5-7H2,1-4H3,(H3,16,17) |
| InChIKey | GDDTVPCAAHCENM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|