C10H13F3N2O2 — CID 103371482
1-(2-cyano-3,3,3-trifluoropropyl)piperidine-4-carboxylic acid (PubChem CID 103371482) has the molecular formula C10H13F3N2O2 and a molecular weight of 250.22 g/mol. Its IUPAC name is 1-(2-cyano-3,3,3-trifluoropropyl)piperidine-4-carboxylic acid.
| Compound Name | 1-(2-cyano-3,3,3-trifluoropropyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 103371482 |
| Molecular Formula | C10H13F3N2O2 |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 1-(2-cyano-3,3,3-trifluoropropyl)piperidine-4-carboxylic acid |
| SMILES | N#CC(CN1CCC(C(=O)O)CC1)C(F)(F)F |
| InChI | InChI=1S/C10H13F3N2O2/c11-10(12,13)8(5-14)6-15-3-1-7(2-4-15)9(16)17/h7-8H,1-4,6H2,(H,16,17) |
| InChIKey | GFWDIYSNEGBBKP-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |