C12H7F3N2O2 — CID 103373289
(6-methoxypyridazin-3-yl)-(2,3,4-trifluorophenyl)methanone (PubChem CID 103373289) has the molecular formula C12H7F3N2O2 and a molecular weight of 268.19 g/mol. Its IUPAC name is (6-methoxypyridazin-3-yl)-(2,3,4-trifluorophenyl)methanone.
| Compound Name | (6-methoxypyridazin-3-yl)-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 103373289 |
| Molecular Formula | C12H7F3N2O2 |
| Molecular Weight | 268.19 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | (6-methoxypyridazin-3-yl)-(2,3,4-trifluorophenyl)methanone |
| SMILES | COc1ccc(C(=O)c2ccc(F)c(F)c2F)nn1 |
| InChI | InChI=1S/C12H7F3N2O2/c1-19-9-5-4-8(16-17-9)12(18)6-2-3-7(13)11(15)10(6)14/h2-5H,1H3 |
| InChIKey | XIFWLHHMFLEULS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.19 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|