C13H12ClFN2O2 — CID 103373422
2-(4-chloro-2-fluorophenyl)-1-(6-methoxypyridazin-3-yl)ethanol (PubChem CID 103373422) has the molecular formula C13H12ClFN2O2 and a molecular weight of 282.70 g/mol. Its IUPAC name is 2-(4-chloro-2-fluorophenyl)-1-(6-methoxypyridazin-3-yl)ethanol.
| Compound Name | 2-(4-chloro-2-fluorophenyl)-1-(6-methoxypyridazin-3-yl)ethanol |
|---|---|
| PubChem CID | 103373422 |
| Molecular Formula | C13H12ClFN2O2 |
| Molecular Weight | 282.70 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 2-(4-chloro-2-fluorophenyl)-1-(6-methoxypyridazin-3-yl)ethanol |
| SMILES | COc1ccc(C(O)Cc2ccc(Cl)cc2F)nn1 |
| InChI | InChI=1S/C13H12ClFN2O2/c1-19-13-5-4-11(16-17-13)12(18)6-8-2-3-9(14)7-10(8)15/h2-5,7,12,18H,6H2,1H3 |
| InChIKey | KWTAHPUCTGSCEA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.70 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |