C13H19N3O — CID 103374699
1-(6-methoxypyridazin-3-yl)-N-propylpent-3-yn-1-amine (PubChem CID 103374699) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is 1-(6-methoxypyridazin-3-yl)-N-propylpent-3-yn-1-amine.
| Compound Name | 1-(6-methoxypyridazin-3-yl)-N-propylpent-3-yn-1-amine |
|---|---|
| PubChem CID | 103374699 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 1-(6-methoxypyridazin-3-yl)-N-propylpent-3-yn-1-amine |
| SMILES | CC#CCC(NCCC)c1ccc(OC)nn1 |
| InChI | InChI=1S/C13H19N3O/c1-4-6-7-11(14-10-5-2)12-8-9-13(17-3)16-15-12/h8-9,11,14H,5,7,10H2,1-3H3 |
| InChIKey | UJVHRWISOQOEGE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|