C12H19N3 — CID 65198238
1-(1-methylpyrazol-3-yl)-N-propylpent-3-yn-1-amine (PubChem CID 65198238) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is 1-(1-methylpyrazol-3-yl)-N-propylpent-3-yn-1-amine.
| Compound Name | 1-(1-methylpyrazol-3-yl)-N-propylpent-3-yn-1-amine |
|---|---|
| PubChem CID | 65198238 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 1-(1-methylpyrazol-3-yl)-N-propylpent-3-yn-1-amine |
| SMILES | CC#CCC(NCCC)c1ccn(C)n1 |
| InChI | InChI=1S/C12H19N3/c1-4-6-7-11(13-9-5-2)12-8-10-15(3)14-12/h8,10-11,13H,5,7,9H2,1-3H3 |
| InChIKey | KOPRQLAUKYWQKR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|