C19H27N3O3 — CID 10337628
N,N-dipropyl-4-(2,4,6-trimethoxyphenyl)pyrimidin-2-amine (PubChem CID 10337628) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is N,N-dipropyl-4-(2,4,6-trimethoxyphenyl)pyrimidin-2-amine.
| Compound Name | N,N-dipropyl-4-(2,4,6-trimethoxyphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 10337628 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | N,N-dipropyl-4-(2,4,6-trimethoxyphenyl)pyrimidin-2-amine |
| SMILES | CCCN(CCC)c1nccc(-c2c(OC)cc(OC)cc2OC)n1 |
| InChI | InChI=1S/C19H27N3O3/c1-6-10-22(11-7-2)19-20-9-8-15(21-19)18-16(24-4)12-14(23-3)13-17(18)25-5/h8-9,12-13H,6-7,10-11H2,1-5H3 |
| InChIKey | FSWDQTGMWNJQAQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |