C13H15F3O5 — CID 103377943
2-(3-hydroxybutan-2-yloxy)-2-[4-(trifluoromethoxy)phenyl]acetic acid (PubChem CID 103377943) has the molecular formula C13H15F3O5 and a molecular weight of 308.25 g/mol. Its IUPAC name is 2-(3-hydroxybutan-2-yloxy)-2-[4-(trifluoromethoxy)phenyl]acetic acid.
| Compound Name | 2-(3-hydroxybutan-2-yloxy)-2-[4-(trifluoromethoxy)phenyl]acetic acid |
|---|---|
| PubChem CID | 103377943 |
| Molecular Formula | C13H15F3O5 |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-(3-hydroxybutan-2-yloxy)-2-[4-(trifluoromethoxy)phenyl]acetic acid |
| SMILES | CC(O)C(C)OC(C(=O)O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H15F3O5/c1-7(17)8(2)20-11(12(18)19)9-3-5-10(6-4-9)21-13(14,15)16/h3-8,11,17H,1-2H3,(H,18,19) |
| InChIKey | MYHAYCKVXXVSTA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |