C18H14F3NO3 — CID 10337861
ethyl (E)-4,4,4-trifluoro-3-[(4-oxocyclohexa-2,5-dien-1-ylidene)amino]-2-phenylbut-2-enoate (PubChem CID 10337861) has the molecular formula C18H14F3NO3 and a molecular weight of 349.31 g/mol. Its IUPAC name is ethyl (E)-4,4,4-trifluoro-3-[(4-oxocyclohexa-2,5-dien-1-ylidene)amino]-2-phenylbut-2-enoate.
| Compound Name | ethyl (E)-4,4,4-trifluoro-3-[(4-oxocyclohexa-2,5-dien-1-ylidene)amino]-2-phenylbut-2-enoate |
|---|---|
| PubChem CID | 10337861 |
| Molecular Formula | C18H14F3NO3 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | ethyl (E)-4,4,4-trifluoro-3-[(4-oxocyclohexa-2,5-dien-1-ylidene)amino]-2-phenylbut-2-enoate |
| SMILES | CCOC(=O)/C(=C(/N=C1C=CC(=O)C=C1)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C18H14F3NO3/c1-2-25-17(24)15(12-6-4-3-5-7-12)16(18(19,20)21)22-13-8-10-14(23)11-9-13/h3-11H,2H2,1H3/b16-15+ |
| InChIKey | OWZVYMTVWJQJJZ-FOCLMDBBSA-N |
| XLogP | 3.66 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|