C19H11F6NO3 — CID 5369685
[N-[(Z)-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-yl]-C-phenylcarbonimidoyl] benzoate (PubChem CID 5369685) has the molecular formula C19H11F6NO3 and a molecular weight of 415.29 g/mol. Its IUPAC name is [N-[(Z)-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-yl]-C-phenylcarbonimidoyl] benzoate.
| Compound Name | [N-[(Z)-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-yl]-C-phenylcarbonimidoyl] benzoate |
|---|---|
| PubChem CID | 5369685 |
| Molecular Formula | C19H11F6NO3 |
| Molecular Weight | 415.29 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | [N-[(Z)-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-yl]-C-phenylcarbonimidoyl] benzoate |
| SMILES | O=C(O/C(=N\C(=C/C(=O)C(F)(F)F)C(F)(F)F)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H11F6NO3/c20-18(21,22)14(11-15(27)19(23,24)25)26-16(12-7-3-1-4-8-12)29-17(28)13-9-5-2-6-10-13/h1-11H/b14-11-,26-16- |
| InChIKey | CAAUVILRPQJYFB-NSASKPSKSA-N |
| XLogP | 4.87 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.29 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|