About but-3-ene-1,2-diol
but-3-ene-1,2-diol (PubChem CID 10338) has the molecular formula C4H8O2
and a molecular weight of 88.11 g/mol. Its IUPAC name is but-3-ene-1,2-diol.
Molecular Properties
| Compound Name | but-3-ene-1,2-diol |
| PubChem CID | 10338 |
| Molecular Formula | C4H8O2 |
| Molecular Weight | 88.11 g/mol |
| Exact Mass | 88.05 |
| IUPAC Name | but-3-ene-1,2-diol |
| SMILES | C=CC(O)CO |
| InChI | InChI=1S/C4H8O2/c1-2-4(6)3-5/h2,4-6H,1,3H2 |
| InChIKey | ITMIAZBRRZANGB-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 88.11 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-3-ene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-ene-1,2-diol?
The IUPAC name of but-3-ene-1,2-diol (CID 10338) is but-3-ene-1,2-diol.
What is the SMILES notation for but-3-ene-1,2-diol?
The canonical SMILES for but-3-ene-1,2-diol is C=CC(O)CO.
What is the InChIKey of but-3-ene-1,2-diol?
The InChIKey is ITMIAZBRRZANGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2/c1-2-4(6)3-5/h2,4-6H,1,3H2.
What are the key properties of but-3-ene-1,2-diol?
but-3-ene-1,2-diol has a molecular weight of 88.11 g/mol, XLogP of -0.47, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-ene-1,2-diol is sourced from PubChem (CID 10338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).