C17H25N3S — CID 103380451
5-N-pentyl-4-phenyl-5-N-propan-2-yl-1,2-thiazole-3,5-diamine (PubChem CID 103380451) has the molecular formula C17H25N3S and a molecular weight of 303.47 g/mol. Its IUPAC name is 5-N-pentyl-4-phenyl-5-N-propan-2-yl-1,2-thiazole-3,5-diamine.
| Compound Name | 5-N-pentyl-4-phenyl-5-N-propan-2-yl-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103380451 |
| Molecular Formula | C17H25N3S |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 5-N-pentyl-4-phenyl-5-N-propan-2-yl-1,2-thiazole-3,5-diamine |
| SMILES | CCCCCN(c1snc(N)c1-c1ccccc1)C(C)C |
| InChI | InChI=1S/C17H25N3S/c1-4-5-9-12-20(13(2)3)17-15(16(18)19-21-17)14-10-7-6-8-11-14/h6-8,10-11,13H,4-5,9,12H2,1-3H3,(H2,18,19) |
| InChIKey | VQRYDBIJMUKGGL-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|