C16H25N5 — CID 103386341
N-[[1-(1-methylimidazo[4,5-c]pyridin-4-yl)piperidin-3-yl]methyl]propan-1-amine (PubChem CID 103386341) has the molecular formula C16H25N5 and a molecular weight of 287.41 g/mol. Its IUPAC name is N-[[1-(1-methylimidazo[4,5-c]pyridin-4-yl)piperidin-3-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-(1-methylimidazo[4,5-c]pyridin-4-yl)piperidin-3-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 103386341 |
| Molecular Formula | C16H25N5 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | N-[[1-(1-methylimidazo[4,5-c]pyridin-4-yl)piperidin-3-yl]methyl]propan-1-amine |
| SMILES | CCCNCC1CCCN(c2nccc3c2ncn3C)C1 |
| InChI | InChI=1S/C16H25N5/c1-3-7-17-10-13-5-4-9-21(11-13)16-15-14(6-8-18-16)20(2)12-19-15/h6,8,12-13,17H,3-5,7,9-11H2,1-2H3 |
| InChIKey | FEDNGHLZCKLSPA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|