C20H21ClN4O — CID 10339058
4-[4-(4-chlorophenyl)-3-methoxy-1-piperidin-4-ylpyrazol-5-yl]pyridine (PubChem CID 10339058) has the molecular formula C20H21ClN4O and a molecular weight of 368.87 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)-3-methoxy-1-piperidin-4-ylpyrazol-5-yl]pyridine.
| Compound Name | 4-[4-(4-chlorophenyl)-3-methoxy-1-piperidin-4-ylpyrazol-5-yl]pyridine |
|---|---|
| PubChem CID | 10339058 |
| Molecular Formula | C20H21ClN4O |
| Molecular Weight | 368.87 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 4-[4-(4-chlorophenyl)-3-methoxy-1-piperidin-4-ylpyrazol-5-yl]pyridine |
| SMILES | COc1nn(C2CCNCC2)c(-c2ccncc2)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H21ClN4O/c1-26-20-18(14-2-4-16(21)5-3-14)19(15-6-10-22-11-7-15)25(24-20)17-8-12-23-13-9-17/h2-7,10-11,17,23H,8-9,12-13H2,1H3 |
| InChIKey | INYICORCAYBJSD-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.87 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |